C25H26F3N3O5 — CID 68533580
1-[2-[2-[2-(2-methoxyethoxy)propan-2-yl]phenoxy]-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 68533580) has the molecular formula C25H26F3N3O5 and a molecular weight of 505.49 g/mol. Its IUPAC name is 1-[2-[2-[2-(2-methoxyethoxy)propan-2-yl]phenoxy]-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[2-[2-[2-(2-methoxyethoxy)propan-2-yl]phenoxy]-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 68533580 |
| Molecular Formula | C25H26F3N3O5 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 1-[2-[2-[2-(2-methoxyethoxy)propan-2-yl]phenoxy]-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | COCCOC(C)(C)c1ccccc1Oc1ncccc1NC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H26F3N3O5/c1-24(2,34-16-15-33-3)19-7-4-5-9-21(19)35-22-20(8-6-14-29-22)31-23(32)30-17-10-12-18(13-11-17)36-25(26,27)28/h4-14H,15-16H2,1-3H3,(H2,30,31,32) |
| InChIKey | LJJHMFGSKNDYIY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|