C26H32N4O3 — CID 68533711
1-[4-(4-aminobutoxy)phenyl]-3-[2-(2-tert-butylphenoxy)-3-pyridinyl]urea (PubChem CID 68533711) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-[4-(4-aminobutoxy)phenyl]-3-[2-(2-tert-butylphenoxy)-3-pyridinyl]urea.
| Compound Name | 1-[4-(4-aminobutoxy)phenyl]-3-[2-(2-tert-butylphenoxy)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 68533711 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 1-[4-(4-aminobutoxy)phenyl]-3-[2-(2-tert-butylphenoxy)-3-pyridinyl]urea |
| SMILES | CC(C)(C)c1ccccc1Oc1ncccc1NC(=O)Nc1ccc(OCCCCN)cc1 |
| InChI | InChI=1S/C26H32N4O3/c1-26(2,3)21-9-4-5-11-23(21)33-24-22(10-8-17-28-24)30-25(31)29-19-12-14-20(15-13-19)32-18-7-6-16-27/h4-5,8-15,17H,6-7,16,18,27H2,1-3H3,(H2,29,30,31) |
| InChIKey | AACVPJMJHCQHOD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|