C25H23F6N3O3 — CID 87486477
1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]urea (PubChem CID 87486477) has the molecular formula C25H23F6N3O3 and a molecular weight of 527.47 g/mol. Its IUPAC name is 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]urea.
| Compound Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 87486477 |
| Molecular Formula | C25H23F6N3O3 |
| Molecular Weight | 527.47 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]urea |
| SMILES | CC(C)(C)c1ccccc1Oc1ncccc1NC(=O)Nc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H23F6N3O3/c1-22(2,3)17-7-4-5-9-19(17)37-20-18(8-6-14-32-20)34-21(35)33-16-12-10-15(11-13-16)23(36,24(26,27)28)25(29,30)31/h4-14,36H,1-3H3,(H2,33,34,35) |
| InChIKey | FOVZOEZRIOHKLG-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.47 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |