C22H21BrFN3O2 — CID 68533805
1-(4-bromo-2-fluorophenyl)-3-[2-(2-tert-butylphenoxy)-3-pyridinyl]urea (PubChem CID 68533805) has the molecular formula C22H21BrFN3O2 and a molecular weight of 458.33 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-[2-(2-tert-butylphenoxy)-3-pyridinyl]urea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-[2-(2-tert-butylphenoxy)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 68533805 |
| Molecular Formula | C22H21BrFN3O2 |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-[2-(2-tert-butylphenoxy)-3-pyridinyl]urea |
| SMILES | CC(C)(C)c1ccccc1Oc1ncccc1NC(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C22H21BrFN3O2/c1-22(2,3)15-7-4-5-9-19(15)29-20-18(8-6-12-25-20)27-21(28)26-17-11-10-14(23)13-16(17)24/h4-13H,1-3H3,(H2,26,27,28) |
| InChIKey | RICAUZKZDGNVIN-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |