C24H23BrN2O2 — CID 68645348
(E)-3-(3-bromophenyl)-N-[2-(2-tert-butylphenoxy)-3-pyridinyl]prop-2-enamide (PubChem CID 68645348) has the molecular formula C24H23BrN2O2 and a molecular weight of 451.36 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-N-[2-(2-tert-butylphenoxy)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-3-(3-bromophenyl)-N-[2-(2-tert-butylphenoxy)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 68645348 |
| Molecular Formula | C24H23BrN2O2 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | (E)-3-(3-bromophenyl)-N-[2-(2-tert-butylphenoxy)-3-pyridinyl]prop-2-enamide |
| SMILES | CC(C)(C)c1ccccc1Oc1ncccc1NC(=O)/C=C/c1cccc(Br)c1 |
| InChI | InChI=1S/C24H23BrN2O2/c1-24(2,3)19-10-4-5-12-21(19)29-23-20(11-7-15-26-23)27-22(28)14-13-17-8-6-9-18(25)16-17/h4-16H,1-3H3,(H,27,28)/b14-13+ |
| InChIKey | QXTSCVYPFRKYNS-BUHFOSPRSA-N |
| XLogP | 6.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|