C25H29FN4O2 — CID 68528415
1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[4-[(dimethylamino)methyl]-2-fluorophenyl]urea (PubChem CID 68528415) has the molecular formula C25H29FN4O2 and a molecular weight of 436.53 g/mol. Its IUPAC name is 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[4-[(dimethylamino)methyl]-2-fluorophenyl]urea.
| Compound Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[4-[(dimethylamino)methyl]-2-fluorophenyl]urea |
|---|---|
| PubChem CID | 68528415 |
| Molecular Formula | C25H29FN4O2 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[4-[(dimethylamino)methyl]-2-fluorophenyl]urea |
| SMILES | CN(C)Cc1ccc(NC(=O)Nc2cccnc2Oc2ccccc2C(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C25H29FN4O2/c1-25(2,3)18-9-6-7-11-22(18)32-23-21(10-8-14-27-23)29-24(31)28-20-13-12-17(15-19(20)26)16-30(4)5/h6-15H,16H2,1-5H3,(H2,28,29,31) |
| InChIKey | ONQDESOFKJMXHM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |