C33H31N3O3 — CID 68531646
1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[3-(naphthalen-2-ylmethoxy)phenyl]urea (PubChem CID 68531646) has the molecular formula C33H31N3O3 and a molecular weight of 517.63 g/mol. Its IUPAC name is 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[3-(naphthalen-2-ylmethoxy)phenyl]urea.
| Compound Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[3-(naphthalen-2-ylmethoxy)phenyl]urea |
|---|---|
| PubChem CID | 68531646 |
| Molecular Formula | C33H31N3O3 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[3-(naphthalen-2-ylmethoxy)phenyl]urea |
| SMILES | CC(C)(C)c1ccccc1Oc1ncccc1NC(=O)Nc1cccc(OCc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C33H31N3O3/c1-33(2,3)28-14-6-7-16-30(28)39-31-29(15-9-19-34-31)36-32(37)35-26-12-8-13-27(21-26)38-22-23-17-18-24-10-4-5-11-25(24)20-23/h4-21H,22H2,1-3H3,(H2,35,36,37) |
| InChIKey | AIEPZZYNMACEDH-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |