C25H29N3O3 — CID 68534808
1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[1-(3-methoxyphenyl)ethyl]urea (PubChem CID 68534808) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[1-(3-methoxyphenyl)ethyl]urea.
| Compound Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[1-(3-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 68534808 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[1-(3-methoxyphenyl)ethyl]urea |
| SMILES | COc1cccc(C(C)NC(=O)Nc2cccnc2Oc2ccccc2C(C)(C)C)c1 |
| InChI | InChI=1S/C25H29N3O3/c1-17(18-10-8-11-19(16-18)30-5)27-24(29)28-21-13-9-15-26-23(21)31-22-14-7-6-12-20(22)25(2,3)4/h6-17H,1-5H3,(H2,27,28,29) |
| InChIKey | GGFQQZUYAHOAFF-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |