C21H16F3N3O3 — CID 68533124
1-[2-(2-ethenylphenoxy)-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 68533124) has the molecular formula C21H16F3N3O3 and a molecular weight of 415.37 g/mol. Its IUPAC name is 1-[2-(2-ethenylphenoxy)-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[2-(2-ethenylphenoxy)-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 68533124 |
| Molecular Formula | C21H16F3N3O3 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 1-[2-(2-ethenylphenoxy)-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | C=Cc1ccccc1Oc1ncccc1NC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F3N3O3/c1-2-14-6-3-4-8-18(14)29-19-17(7-5-13-25-19)27-20(28)26-15-9-11-16(12-10-15)30-21(22,23)24/h2-13H,1H2,(H2,26,27,28) |
| InChIKey | GCBYXOMNQBPQSA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |