C26H28F3N3O4 — CID 68532058
1-[2-[2-(3-ethoxypentan-3-yl)phenoxy]-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 68532058) has the molecular formula C26H28F3N3O4 and a molecular weight of 503.52 g/mol. Its IUPAC name is 1-[2-[2-(3-ethoxypentan-3-yl)phenoxy]-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[2-[2-(3-ethoxypentan-3-yl)phenoxy]-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 68532058 |
| Molecular Formula | C26H28F3N3O4 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 1-[2-[2-(3-ethoxypentan-3-yl)phenoxy]-3-pyridinyl]-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | CCOC(CC)(CC)c1ccccc1Oc1ncccc1NC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H28F3N3O4/c1-4-25(5-2,34-6-3)20-10-7-8-12-22(20)35-23-21(11-9-17-30-23)32-24(33)31-18-13-15-19(16-14-18)36-26(27,28)29/h7-17H,4-6H2,1-3H3,(H2,31,32,33) |
| InChIKey | YMFDAJNFBPDYRY-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |