C28H27N3O2 — CID 68528476
1-(4-tert-butylphenyl)-3-[2-(3-phenylphenoxy)-3-pyridinyl]urea (PubChem CID 68528476) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[2-(3-phenylphenoxy)-3-pyridinyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[2-(3-phenylphenoxy)-3-pyridinyl]urea |
|---|---|
| PubChem CID | 68528476 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[2-(3-phenylphenoxy)-3-pyridinyl]urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)Nc2cccnc2Oc2cccc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H27N3O2/c1-28(2,3)22-14-16-23(17-15-22)30-27(32)31-25-13-8-18-29-26(25)33-24-12-7-11-21(19-24)20-9-5-4-6-10-20/h4-19H,1-3H3,(H2,30,31,32) |
| InChIKey | MHBLNILRVMPYTE-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |