C23H17ClF4N4O3 — CID 134123737
2-chloro-N-[(2E)-2-(3-fluorophenyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]ethyl]benzamide (PubChem CID 134123737) has the molecular formula C23H17ClF4N4O3 and a molecular weight of 508.86 g/mol. Its IUPAC name is 2-chloro-N-[(2E)-2-(3-fluorophenyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]ethyl]benzamide.
| Compound Name | 2-chloro-N-[(2E)-2-(3-fluorophenyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]ethyl]benzamide |
|---|---|
| PubChem CID | 134123737 |
| Molecular Formula | C23H17ClF4N4O3 |
| Molecular Weight | 508.86 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | 2-chloro-N-[(2E)-2-(3-fluorophenyl)-2-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]ethyl]benzamide |
| SMILES | O=C(N/N=C(/CNC(=O)c1ccccc1Cl)c1cccc(F)c1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H17ClF4N4O3/c24-19-7-2-1-6-18(19)21(33)29-13-20(14-4-3-5-15(25)12-14)31-32-22(34)30-16-8-10-17(11-9-16)35-23(26,27)28/h1-12H,13H2,(H,29,33)(H2,30,32,34)/b31-20- |
| InChIKey | QKQZPPYGHBJBIU-GTWSWNCMSA-N |
| XLogP | 5.33 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.86 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|