C16H13ClFN3O3 — CID 35929184
N-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-3-fluorobenzamide (PubChem CID 35929184) has the molecular formula C16H13ClFN3O3 and a molecular weight of 349.75 g/mol. Its IUPAC name is N-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-3-fluorobenzamide.
| Compound Name | N-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 35929184 |
| Molecular Formula | C16H13ClFN3O3 |
| Molecular Weight | 349.75 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N-[2-[2-(2-chlorobenzoyl)hydrazinyl]-2-oxoethyl]-3-fluorobenzamide |
| SMILES | O=C(CNC(=O)c1cccc(F)c1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H13ClFN3O3/c17-13-7-2-1-6-12(13)16(24)21-20-14(22)9-19-15(23)10-4-3-5-11(18)8-10/h1-8H,9H2,(H,19,23)(H,20,22)(H,21,24) |
| InChIKey | QGVLAKWEPYNSCI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.75 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|