C15H11Cl2FN2O2 — CID 113001247
N-[2-(2,4-dichloroanilino)-2-oxoethyl]-3-fluorobenzamide (PubChem CID 113001247) has the molecular formula C15H11Cl2FN2O2 and a molecular weight of 341.17 g/mol. Its IUPAC name is N-[2-(2,4-dichloroanilino)-2-oxoethyl]-3-fluorobenzamide.
| Compound Name | N-[2-(2,4-dichloroanilino)-2-oxoethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 113001247 |
| Molecular Formula | C15H11Cl2FN2O2 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | N-[2-(2,4-dichloroanilino)-2-oxoethyl]-3-fluorobenzamide |
| SMILES | O=C(CNC(=O)c1cccc(F)c1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H11Cl2FN2O2/c16-10-4-5-13(12(17)7-10)20-14(21)8-19-15(22)9-2-1-3-11(18)6-9/h1-7H,8H2,(H,19,22)(H,20,21) |
| InChIKey | SUCPRZQBVQZUCH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |