C16H15ClFN3O2 — CID 82034776
N-[2-(3-aminopropanoylamino)-4-chlorophenyl]-3-fluorobenzamide (PubChem CID 82034776) has the molecular formula C16H15ClFN3O2 and a molecular weight of 335.77 g/mol. Its IUPAC name is N-[2-(3-aminopropanoylamino)-4-chlorophenyl]-3-fluorobenzamide.
| Compound Name | N-[2-(3-aminopropanoylamino)-4-chlorophenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 82034776 |
| Molecular Formula | C16H15ClFN3O2 |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | N-[2-(3-aminopropanoylamino)-4-chlorophenyl]-3-fluorobenzamide |
| SMILES | NCCC(=O)Nc1cc(Cl)ccc1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C16H15ClFN3O2/c17-11-4-5-13(14(9-11)20-15(22)6-7-19)21-16(23)10-2-1-3-12(18)8-10/h1-5,8-9H,6-7,19H2,(H,20,22)(H,21,23) |
| InChIKey | AFGZCHMKVGSUJD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |