C16H13ClF2N2O2 — CID 86865949
N-[2-(2-chloro-4-methylanilino)-2-oxoethyl]-2,6-difluorobenzamide (PubChem CID 86865949) has the molecular formula C16H13ClF2N2O2 and a molecular weight of 338.74 g/mol. Its IUPAC name is N-[2-(2-chloro-4-methylanilino)-2-oxoethyl]-2,6-difluorobenzamide.
| Compound Name | N-[2-(2-chloro-4-methylanilino)-2-oxoethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 86865949 |
| Molecular Formula | C16H13ClF2N2O2 |
| Molecular Weight | 338.74 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-[2-(2-chloro-4-methylanilino)-2-oxoethyl]-2,6-difluorobenzamide |
| SMILES | Cc1ccc(NC(=O)CNC(=O)c2c(F)cccc2F)c(Cl)c1 |
| InChI | InChI=1S/C16H13ClF2N2O2/c1-9-5-6-13(10(17)7-9)21-14(22)8-20-16(23)15-11(18)3-2-4-12(15)19/h2-7H,8H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | YBHPRRKPNDXVDA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.74 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |