C25H21F3N4O3 — CID 134107295
3-methyl-N-[(3E)-3-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]benzamide (PubChem CID 134107295) has the molecular formula C25H21F3N4O3 and a molecular weight of 482.46 g/mol. Its IUPAC name is 3-methyl-N-[(3E)-3-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]benzamide.
| Compound Name | 3-methyl-N-[(3E)-3-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]benzamide |
|---|---|
| PubChem CID | 134107295 |
| Molecular Formula | C25H21F3N4O3 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 3-methyl-N-[(3E)-3-[[4-(trifluoromethoxy)phenyl]carbamoylhydrazinylidene]-1,2-dihydroinden-2-yl]benzamide |
| SMILES | Cc1cccc(C(=O)NC2Cc3ccccc3/C2=N\NC(=O)Nc2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C25H21F3N4O3/c1-15-5-4-7-17(13-15)23(33)30-21-14-16-6-2-3-8-20(16)22(21)31-32-24(34)29-18-9-11-19(12-10-18)35-25(26,27)28/h2-13,21H,14H2,1H3,(H,30,33)(H2,29,32,34)/b31-22+ |
| InChIKey | ACZAGMPXVJGIFR-DFKUXCBWSA-N |
| XLogP | 4.77 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|