C25H22F3N3O3 — CID 67929433
ethyl N-[[4-(trifluoromethoxy)phenyl]carbamoyl]-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate (PubChem CID 67929433) has the molecular formula C25H22F3N3O3 and a molecular weight of 469.46 g/mol. Its IUPAC name is ethyl N-[[4-(trifluoromethoxy)phenyl]carbamoyl]-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate.
| Compound Name | ethyl N-[[4-(trifluoromethoxy)phenyl]carbamoyl]-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
|---|---|
| PubChem CID | 67929433 |
| Molecular Formula | C25H22F3N3O3 |
| Molecular Weight | 469.46 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | ethyl N-[[4-(trifluoromethoxy)phenyl]carbamoyl]-5,7-dihydrobenzo[d][2]benzazepine-6-carboximidate |
| SMILES | CCOC(=NC(=O)Nc1ccc(OC(F)(F)F)cc1)N1Cc2ccccc2-c2ccccc2C1 |
| InChI | InChI=1S/C25H22F3N3O3/c1-2-33-24(30-23(32)29-19-11-13-20(14-12-19)34-25(26,27)28)31-15-17-7-3-5-9-21(17)22-10-6-4-8-18(22)16-31/h3-14H,2,15-16H2,1H3,(H,29,32) |
| InChIKey | NOJQQQPLYGHJFS-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.46 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|