C14H17F3N2O3 — CID 111976217
1-(2-cyclopropyl-1-hydroxypropan-2-yl)-3-[4-(trifluoromethoxy)phenyl]urea (PubChem CID 111976217) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.30 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1-hydroxypropan-2-yl)-3-[4-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(2-cyclopropyl-1-hydroxypropan-2-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 111976217 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-(2-cyclopropyl-1-hydroxypropan-2-yl)-3-[4-(trifluoromethoxy)phenyl]urea |
| SMILES | CC(CO)(NC(=O)Nc1ccc(OC(F)(F)F)cc1)C1CC1 |
| InChI | InChI=1S/C14H17F3N2O3/c1-13(8-20,9-2-3-9)19-12(21)18-10-4-6-11(7-5-10)22-14(15,16)17/h4-7,9,20H,2-3,8H2,1H3,(H2,18,19,21) |
| InChIKey | SKFHSHCVDKACLX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |