C14H17F3N2O4 — CID 139384591
2-ethyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]butanoic acid (PubChem CID 139384591) has the molecular formula C14H17F3N2O4 and a molecular weight of 334.29 g/mol. Its IUPAC name is 2-ethyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]butanoic acid.
| Compound Name | 2-ethyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 139384591 |
| Molecular Formula | C14H17F3N2O4 |
| Molecular Weight | 334.29 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-ethyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]butanoic acid |
| SMILES | CCC(CC)(NC(=O)Nc1ccc(OC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C14H17F3N2O4/c1-3-13(4-2,11(20)21)19-12(22)18-9-5-7-10(8-6-9)23-14(15,16)17/h5-8H,3-4H2,1-2H3,(H,20,21)(H2,18,19,22) |
| InChIKey | DUHDLMOECRNZTH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |