C14H17F3N2O3 — CID 139384639
2-ethyl-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid (PubChem CID 139384639) has the molecular formula C14H17F3N2O3 and a molecular weight of 318.30 g/mol. Its IUPAC name is 2-ethyl-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid.
| Compound Name | 2-ethyl-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 139384639 |
| Molecular Formula | C14H17F3N2O3 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-ethyl-2-[[4-(trifluoromethyl)phenyl]carbamoylamino]butanoic acid |
| SMILES | CCC(CC)(NC(=O)Nc1ccc(C(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C14H17F3N2O3/c1-3-13(4-2,11(20)21)19-12(22)18-10-7-5-9(6-8-10)14(15,16)17/h5-8H,3-4H2,1-2H3,(H,20,21)(H2,18,19,22) |
| InChIKey | VOERDAYJMLXPHF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |