C15H19F3N2O4 — CID 139384617
2-ethyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pentanoic acid (PubChem CID 139384617) has the molecular formula C15H19F3N2O4 and a molecular weight of 348.32 g/mol. Its IUPAC name is 2-ethyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pentanoic acid.
| Compound Name | 2-ethyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 139384617 |
| Molecular Formula | C15H19F3N2O4 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-ethyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]pentanoic acid |
| SMILES | CCCC(CC)(NC(=O)Nc1ccc(OC(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C15H19F3N2O4/c1-3-9-14(4-2,12(21)22)20-13(23)19-10-5-7-11(8-6-10)24-15(16,17)18/h5-8H,3-4,9H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | OAKUPKDSIJLFAS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |