C18H15F6N3O4 — CID 40842222
methyl (2S)-2-anilino-3,3,3-trifluoro-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]propanoate (PubChem CID 40842222) has the molecular formula C18H15F6N3O4 and a molecular weight of 451.32 g/mol. Its IUPAC name is methyl (2S)-2-anilino-3,3,3-trifluoro-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]propanoate.
| Compound Name | methyl (2S)-2-anilino-3,3,3-trifluoro-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 40842222 |
| Molecular Formula | C18H15F6N3O4 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | methyl (2S)-2-anilino-3,3,3-trifluoro-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]propanoate |
| SMILES | COC(=O)[C@@](NC(=O)Nc1ccc(OC(F)(F)F)cc1)(Nc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H15F6N3O4/c1-30-14(28)16(17(19,20)21,26-12-5-3-2-4-6-12)27-15(29)25-11-7-9-13(10-8-11)31-18(22,23)24/h2-10,26H,1H3,(H2,25,27,29)/t16-/m0/s1 |
| InChIKey | KNPBQBVYSPGTJH-INIZCTEOSA-N |
| XLogP | 4.25 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|