C14H14F6N2O4 — CID 4593681
methyl 3,3,3-trifluoro-2-(propanoylamino)-2-[4-(trifluoromethoxy)anilino]propanoate (PubChem CID 4593681) has the molecular formula C14H14F6N2O4 and a molecular weight of 388.26 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-(propanoylamino)-2-[4-(trifluoromethoxy)anilino]propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-(propanoylamino)-2-[4-(trifluoromethoxy)anilino]propanoate |
|---|---|
| PubChem CID | 4593681 |
| Molecular Formula | C14H14F6N2O4 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-(propanoylamino)-2-[4-(trifluoromethoxy)anilino]propanoate |
| SMILES | CCC(=O)NC(Nc1ccc(OC(F)(F)F)cc1)(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C14H14F6N2O4/c1-3-10(23)22-12(11(24)25-2,13(15,16)17)21-8-4-6-9(7-5-8)26-14(18,19)20/h4-7,21H,3H2,1-2H3,(H,22,23) |
| InChIKey | UCIHCGBFAWQQHO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|