C17H17ClF6N2O6 — CID 4137146
methyl 2-[4-[[2-[(2-chloroacetyl)amino]-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]amino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 4137146) has the molecular formula C17H17ClF6N2O6 and a molecular weight of 494.77 g/mol. Its IUPAC name is methyl 2-[4-[[2-[(2-chloroacetyl)amino]-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]amino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | methyl 2-[4-[[2-[(2-chloroacetyl)amino]-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]amino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 4137146 |
| Molecular Formula | C17H17ClF6N2O6 |
| Molecular Weight | 494.77 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | methyl 2-[4-[[2-[(2-chloroacetyl)amino]-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]amino]phenyl]-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | CCOC(=O)C(NC(=O)CCl)(Nc1ccc(C(O)(C(=O)OC)C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C17H17ClF6N2O6/c1-3-32-13(29)15(17(22,23)24,26-11(27)8-18)25-10-6-4-9(5-7-10)14(30,12(28)31-2)16(19,20)21/h4-7,25,30H,3,8H2,1-2H3,(H,26,27) |
| InChIKey | TUZQMLGTDBPSCW-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.77 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|