C15H20N2O3 — CID 111975992
N'-(2-cyclopropyl-1-hydroxypropan-2-yl)-N-(4-methylphenyl)oxamide (PubChem CID 111975992) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N'-(2-cyclopropyl-1-hydroxypropan-2-yl)-N-(4-methylphenyl)oxamide.
| Compound Name | N'-(2-cyclopropyl-1-hydroxypropan-2-yl)-N-(4-methylphenyl)oxamide |
|---|---|
| PubChem CID | 111975992 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N'-(2-cyclopropyl-1-hydroxypropan-2-yl)-N-(4-methylphenyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NC(C)(CO)C2CC2)cc1 |
| InChI | InChI=1S/C15H20N2O3/c1-10-3-7-12(8-4-10)16-13(19)14(20)17-15(2,9-18)11-5-6-11/h3-4,7-8,11,18H,5-6,9H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | FJYNIVHZLSPVPQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|