C16H24N2O3 — CID 111976318
1-(2-cyclopropyl-1-hydroxypropan-2-yl)-3-(2-ethoxy-4-methylphenyl)urea (PubChem CID 111976318) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1-hydroxypropan-2-yl)-3-(2-ethoxy-4-methylphenyl)urea.
| Compound Name | 1-(2-cyclopropyl-1-hydroxypropan-2-yl)-3-(2-ethoxy-4-methylphenyl)urea |
|---|---|
| PubChem CID | 111976318 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1-(2-cyclopropyl-1-hydroxypropan-2-yl)-3-(2-ethoxy-4-methylphenyl)urea |
| SMILES | CCOc1cc(C)ccc1NC(=O)NC(C)(CO)C1CC1 |
| InChI | InChI=1S/C16H24N2O3/c1-4-21-14-9-11(2)5-8-13(14)17-15(20)18-16(3,10-19)12-6-7-12/h5,8-9,12,19H,4,6-7,10H2,1-3H3,(H2,17,18,20) |
| InChIKey | WZMOWJJFGZBFCV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |