C14H16ClF3N2O2 — CID 111976400
1-[2-chloro-4-(trifluoromethyl)phenyl]-3-(2-cyclopropyl-1-hydroxypropan-2-yl)urea (PubChem CID 111976400) has the molecular formula C14H16ClF3N2O2 and a molecular weight of 336.74 g/mol. Its IUPAC name is 1-[2-chloro-4-(trifluoromethyl)phenyl]-3-(2-cyclopropyl-1-hydroxypropan-2-yl)urea.
| Compound Name | 1-[2-chloro-4-(trifluoromethyl)phenyl]-3-(2-cyclopropyl-1-hydroxypropan-2-yl)urea |
|---|---|
| PubChem CID | 111976400 |
| Molecular Formula | C14H16ClF3N2O2 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-[2-chloro-4-(trifluoromethyl)phenyl]-3-(2-cyclopropyl-1-hydroxypropan-2-yl)urea |
| SMILES | CC(CO)(NC(=O)Nc1ccc(C(F)(F)F)cc1Cl)C1CC1 |
| InChI | InChI=1S/C14H16ClF3N2O2/c1-13(7-21,8-2-3-8)20-12(22)19-11-5-4-9(6-10(11)15)14(16,17)18/h4-6,8,21H,2-3,7H2,1H3,(H2,19,20,22) |
| InChIKey | ITWAKVHFDOSARM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |