C19H21Cl2N3O — CID 167873930
1-(1-amino-2-cyclopropylpropan-2-yl)-3-[4-chloro-2-(2-chlorophenyl)phenyl]urea (PubChem CID 167873930) has the molecular formula C19H21Cl2N3O and a molecular weight of 378.30 g/mol. Its IUPAC name is 1-(1-amino-2-cyclopropylpropan-2-yl)-3-[4-chloro-2-(2-chlorophenyl)phenyl]urea.
| Compound Name | 1-(1-amino-2-cyclopropylpropan-2-yl)-3-[4-chloro-2-(2-chlorophenyl)phenyl]urea |
|---|---|
| PubChem CID | 167873930 |
| Molecular Formula | C19H21Cl2N3O |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 1-(1-amino-2-cyclopropylpropan-2-yl)-3-[4-chloro-2-(2-chlorophenyl)phenyl]urea |
| SMILES | CC(CN)(NC(=O)Nc1ccc(Cl)cc1-c1ccccc1Cl)C1CC1 |
| InChI | InChI=1S/C19H21Cl2N3O/c1-19(11-22,12-6-7-12)24-18(25)23-17-9-8-13(20)10-15(17)14-4-2-3-5-16(14)21/h2-5,8-10,12H,6-7,11,22H2,1H3,(H2,23,24,25) |
| InChIKey | CFDYVHLWKSMEHQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |