C14H20N2O5 — CID 122076836
3-[(2-ethoxy-4-methylphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 122076836) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 3-[(2-ethoxy-4-methylphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[(2-ethoxy-4-methylphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122076836 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 3-[(2-ethoxy-4-methylphenyl)carbamoylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CCOc1cc(C)ccc1NC(=O)NCC(C)(O)C(=O)O |
| InChI | InChI=1S/C14H20N2O5/c1-4-21-11-7-9(2)5-6-10(11)16-13(19)15-8-14(3,20)12(17)18/h5-7,20H,4,8H2,1-3H3,(H,17,18)(H2,15,16,19) |
| InChIKey | KSWWMYWSRIKPSZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |