C14H16N2O4 — CID 78922047
(2R)-1-[2-(4-methylanilino)-2-oxoacetyl]pyrrolidine-2-carboxylic acid (PubChem CID 78922047) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is (2R)-1-[2-(4-methylanilino)-2-oxoacetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-(4-methylanilino)-2-oxoacetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 78922047 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (2R)-1-[2-(4-methylanilino)-2-oxoacetyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)C(=O)N2CCC[C@@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C14H16N2O4/c1-9-4-6-10(7-5-9)15-12(17)13(18)16-8-2-3-11(16)14(19)20/h4-7,11H,2-3,8H2,1H3,(H,15,17)(H,19,20)/t11-/m1/s1 |
| InChIKey | OCOSSHJMNRNVRG-LLVKDONJSA-N |
| XLogP | 1.01 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|