C28H20ClNO2S — CID 23096582
3-chloro-N-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]benzamide (PubChem CID 23096582) has the molecular formula C28H20ClNO2S and a molecular weight of 469.99 g/mol. Its IUPAC name is 3-chloro-N-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]benzamide.
| Compound Name | 3-chloro-N-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 23096582 |
| Molecular Formula | C28H20ClNO2S |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | 3-chloro-N-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]benzamide |
| SMILES | O=C(CSc1ccc(NC(=O)c2cccc(Cl)c2)cc1)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C28H20ClNO2S/c29-22-6-3-5-20(16-22)28(32)30-23-9-11-24(12-10-23)33-17-27(31)19-8-13-26-21(15-19)14-18-4-1-2-7-25(18)26/h1-13,15-16H,14,17H2,(H,30,32) |
| InChIKey | MAIOCESYLLTCFE-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |