C27H21NO3S2 — CID 23096843
N-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]benzenesulfonamide (PubChem CID 23096843) has the molecular formula C27H21NO3S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is N-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]benzenesulfonamide.
| Compound Name | N-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 23096843 |
| Molecular Formula | C27H21NO3S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | N-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]benzenesulfonamide |
| SMILES | O=C(CSc1ccc(NS(=O)(=O)c2ccccc2)cc1)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C27H21NO3S2/c29-27(20-10-15-26-21(17-20)16-19-6-4-5-9-25(19)26)18-32-23-13-11-22(12-14-23)28-33(30,31)24-7-2-1-3-8-24/h1-15,17,28H,16,18H2 |
| InChIKey | GXTCZBCBGOJVPF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |