C21H11F5OS — CID 7467328
1-(9H-fluoren-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylethanone (PubChem CID 7467328) has the molecular formula C21H11F5OS and a molecular weight of 406.38 g/mol. Its IUPAC name is 1-(9H-fluoren-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylethanone.
| Compound Name | 1-(9H-fluoren-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylethanone |
|---|---|
| PubChem CID | 7467328 |
| Molecular Formula | C21H11F5OS |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 1-(9H-fluoren-3-yl)-2-(2,3,4,5,6-pentafluorophenyl)sulfanylethanone |
| SMILES | O=C(CSc1c(F)c(F)c(F)c(F)c1F)c1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C21H11F5OS/c22-16-17(23)19(25)21(20(26)18(16)24)28-9-15(27)12-6-5-11-7-10-3-1-2-4-13(10)14(11)8-12/h1-6,8H,7,9H2 |
| InChIKey | YNBSPQWZCYIEOD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|