C15H14N2O — CID 174829565
N'-methyl-9H-fluorene-3-carbohydrazide (PubChem CID 174829565) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is N'-methyl-9H-fluorene-3-carbohydrazide.
| Compound Name | N'-methyl-9H-fluorene-3-carbohydrazide |
|---|---|
| PubChem CID | 174829565 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | N'-methyl-9H-fluorene-3-carbohydrazide |
| SMILES | CNNC(=O)c1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C15H14N2O/c1-16-17-15(18)12-7-6-11-8-10-4-2-3-5-13(10)14(11)9-12/h2-7,9,16H,8H2,1H3,(H,17,18) |
| InChIKey | OKOOTFWACCVJIN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|