C20H23NO2 — CID 97025616
N-[(4R)-4-hydroxyhexyl]-9H-fluorene-2-carboxamide (PubChem CID 97025616) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[(4R)-4-hydroxyhexyl]-9H-fluorene-2-carboxamide.
| Compound Name | N-[(4R)-4-hydroxyhexyl]-9H-fluorene-2-carboxamide |
|---|---|
| PubChem CID | 97025616 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-[(4R)-4-hydroxyhexyl]-9H-fluorene-2-carboxamide |
| SMILES | CC[C@@H](O)CCCNC(=O)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C20H23NO2/c1-2-17(22)7-5-11-21-20(23)15-9-10-19-16(13-15)12-14-6-3-4-8-18(14)19/h3-4,6,8-10,13,17,22H,2,5,7,11-12H2,1H3,(H,21,23)/t17-/m1/s1 |
| InChIKey | DPDWUGJUSLAYGF-QGZVFWFLSA-N |
| XLogP | 3.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|