C17H13ClF3N3O2 — CID 67783514
1-[(6-chloro-2-methyl-1-benzofuran-3-ylidene)amino]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 67783514) has the molecular formula C17H13ClF3N3O2 and a molecular weight of 383.76 g/mol. Its IUPAC name is 1-[(6-chloro-2-methyl-1-benzofuran-3-ylidene)amino]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(6-chloro-2-methyl-1-benzofuran-3-ylidene)amino]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 67783514 |
| Molecular Formula | C17H13ClF3N3O2 |
| Molecular Weight | 383.76 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 1-[(6-chloro-2-methyl-1-benzofuran-3-ylidene)amino]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | CC1Oc2cc(Cl)ccc2C1=NNC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13ClF3N3O2/c1-9-15(13-7-4-11(18)8-14(13)26-9)23-24-16(25)22-12-5-2-10(3-6-12)17(19,20)21/h2-9H,1H3,(H2,22,24,25) |
| InChIKey | HJASEVBGNGAWDE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.76 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|