C28H26Cl3FN4O2 — CID 21173316
1-[(2-chloro-4-fluorophenyl)methyl]-N-[(Z)-1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]piperidine-4-carboxamide (PubChem CID 21173316) has the molecular formula C28H26Cl3FN4O2 and a molecular weight of 575.90 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methyl]-N-[(Z)-1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methyl]-N-[(Z)-1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 21173316 |
| Molecular Formula | C28H26Cl3FN4O2 |
| Molecular Weight | 575.90 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methyl]-N-[(Z)-1-[4-[(2,4-dichlorobenzoyl)amino]phenyl]ethylideneamino]piperidine-4-carboxamide |
| SMILES | C/C(=N/NC(=O)C1CCN(Cc2ccc(F)cc2Cl)CC1)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C28H26Cl3FN4O2/c1-17(18-3-7-23(8-4-18)33-28(38)24-9-5-21(29)14-26(24)31)34-35-27(37)19-10-12-36(13-11-19)16-20-2-6-22(32)15-25(20)30/h2-9,14-15,19H,10-13,16H2,1H3,(H,33,38)(H,35,37)/b34-17- |
| InChIKey | KTPPKSRTDORMKJ-DLCNMLRHSA-N |
| XLogP | 6.79 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.90 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|