C21H23ClFN3O2 — CID 5183602
1-[(2-chloro-4-fluorophenyl)methyl]-N-[1-(4-hydroxyphenyl)ethylideneamino]piperidine-4-carboxamide (PubChem CID 5183602) has the molecular formula C21H23ClFN3O2 and a molecular weight of 403.89 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methyl]-N-[1-(4-hydroxyphenyl)ethylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methyl]-N-[1-(4-hydroxyphenyl)ethylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 5183602 |
| Molecular Formula | C21H23ClFN3O2 |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methyl]-N-[1-(4-hydroxyphenyl)ethylideneamino]piperidine-4-carboxamide |
| SMILES | CC(=NNC(=O)C1CCN(Cc2ccc(F)cc2Cl)CC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H23ClFN3O2/c1-14(15-3-6-19(27)7-4-15)24-25-21(28)16-8-10-26(11-9-16)13-17-2-5-18(23)12-20(17)22/h2-7,12,16,27H,8-11,13H2,1H3,(H,25,28) |
| InChIKey | JGWOEAIRLBDYAK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|