C21H20ClFN4O5 — CID 5454653
1-[(2-chloro-4-fluorophenyl)methyl]-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]piperidine-4-carboxamide (PubChem CID 5454653) has the molecular formula C21H20ClFN4O5 and a molecular weight of 462.87 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methyl]-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]piperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methyl]-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 5454653 |
| Molecular Formula | C21H20ClFN4O5 |
| Molecular Weight | 462.87 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methyl]-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]piperidine-4-carboxamide |
| SMILES | O=C(N/N=C\c1cc2c(cc1[N+](=O)[O-])OCO2)C1CCN(Cc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C21H20ClFN4O5/c22-17-8-16(23)2-1-14(17)11-26-5-3-13(4-6-26)21(28)25-24-10-15-7-19-20(32-12-31-19)9-18(15)27(29)30/h1-2,7-10,13H,3-6,11-12H2,(H,25,28)/b24-10- |
| InChIKey | ZEJYDUZPMRCWHH-VROXFSQNSA-N |
| XLogP | 3.48 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.87 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|