C25H26ClN3O — CID 5179015
1-[(2-chlorophenyl)methyl]-N-(1-naphthalen-2-ylethylideneamino)piperidine-4-carboxamide (PubChem CID 5179015) has the molecular formula C25H26ClN3O and a molecular weight of 419.96 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-N-(1-naphthalen-2-ylethylideneamino)piperidine-4-carboxamide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-N-(1-naphthalen-2-ylethylideneamino)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 5179015 |
| Molecular Formula | C25H26ClN3O |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-N-(1-naphthalen-2-ylethylideneamino)piperidine-4-carboxamide |
| SMILES | CC(=NNC(=O)C1CCN(Cc2ccccc2Cl)CC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H26ClN3O/c1-18(21-11-10-19-6-2-3-7-22(19)16-21)27-28-25(30)20-12-14-29(15-13-20)17-23-8-4-5-9-24(23)26/h2-11,16,20H,12-15,17H2,1H3,(H,28,30) |
| InChIKey | GOGXRRQYQIJNMM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|