C21H23Cl2N3O2 — CID 43924255
N-(4-acetamidophenyl)-1-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 43924255) has the molecular formula C21H23Cl2N3O2 and a molecular weight of 420.34 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-1-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(4-acetamidophenyl)-1-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43924255 |
| Molecular Formula | C21H23Cl2N3O2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-(4-acetamidophenyl)-1-[(2,4-dichlorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C2CCN(Cc3ccc(Cl)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C21H23Cl2N3O2/c1-14(27)24-18-4-6-19(7-5-18)25-21(28)15-8-10-26(11-9-15)13-16-2-3-17(22)12-20(16)23/h2-7,12,15H,8-11,13H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | CDAMNEQOKRMXFM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |