C20H21Cl2FN2O — CID 100684708
1-[(4-chloro-2-fluorophenyl)methyl]-N-(3-chloro-4-methylphenyl)piperidine-4-carboxamide (PubChem CID 100684708) has the molecular formula C20H21Cl2FN2O and a molecular weight of 395.31 g/mol. Its IUPAC name is 1-[(4-chloro-2-fluorophenyl)methyl]-N-(3-chloro-4-methylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(4-chloro-2-fluorophenyl)methyl]-N-(3-chloro-4-methylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100684708 |
| Molecular Formula | C20H21Cl2FN2O |
| Molecular Weight | 395.31 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-[(4-chloro-2-fluorophenyl)methyl]-N-(3-chloro-4-methylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCN(Cc3ccc(Cl)cc3F)CC2)cc1Cl |
| InChI | InChI=1S/C20H21Cl2FN2O/c1-13-2-5-17(11-18(13)22)24-20(26)14-6-8-25(9-7-14)12-15-3-4-16(21)10-19(15)23/h2-5,10-11,14H,6-9,12H2,1H3,(H,24,26) |
| InChIKey | YQYGKUZTKCUSJW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.31 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |