C20H21BrClFN2O — CID 100684851
N-(4-bromo-3-methylphenyl)-1-[(4-chloro-2-fluorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 100684851) has the molecular formula C20H21BrClFN2O and a molecular weight of 439.76 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-1-[(4-chloro-2-fluorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-1-[(4-chloro-2-fluorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100684851 |
| Molecular Formula | C20H21BrClFN2O |
| Molecular Weight | 439.76 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-1-[(4-chloro-2-fluorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CCN(Cc3ccc(Cl)cc3F)CC2)ccc1Br |
| InChI | InChI=1S/C20H21BrClFN2O/c1-13-10-17(4-5-18(13)21)24-20(26)14-6-8-25(9-7-14)12-15-2-3-16(22)11-19(15)23/h2-5,10-11,14H,6-9,12H2,1H3,(H,24,26) |
| InChIKey | CEXQOYYTGVVRQD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.76 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |