C15H9Cl3F3N3O2 — CID 4643198
1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[(2,4-dichlorobenzoyl)amino]urea (PubChem CID 4643198) has the molecular formula C15H9Cl3F3N3O2 and a molecular weight of 426.61 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[(2,4-dichlorobenzoyl)amino]urea.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[(2,4-dichlorobenzoyl)amino]urea |
|---|---|
| PubChem CID | 4643198 |
| Molecular Formula | C15H9Cl3F3N3O2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 424.97 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[(2,4-dichlorobenzoyl)amino]urea |
| SMILES | O=C(NNC(=O)c1ccc(Cl)cc1Cl)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C15H9Cl3F3N3O2/c16-7-2-4-12(10(5-7)15(19,20)21)22-14(26)24-23-13(25)9-3-1-8(17)6-11(9)18/h1-6H,(H,23,25)(H2,22,24,26) |
| InChIKey | ZWNXFDWCUKPSGP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|