C33H44O4 — CID 57483412
6-[4-[3-[4-[2-(1-hydroxycyclohexyl)ethynyl]-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]hexanoic acid (PubChem CID 57483412) has the molecular formula C33H44O4 and a molecular weight of 504.71 g/mol. Its IUPAC name is 6-[4-[3-[4-[2-(1-hydroxycyclohexyl)ethynyl]-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]hexanoic acid.
| Compound Name | 6-[4-[3-[4-[2-(1-hydroxycyclohexyl)ethynyl]-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]hexanoic acid |
|---|---|
| PubChem CID | 57483412 |
| Molecular Formula | C33H44O4 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.32 |
| IUPAC Name | 6-[4-[3-[4-[2-(1-hydroxycyclohexyl)ethynyl]-3-methylphenyl]pentan-3-yl]-2-methylphenoxy]hexanoic acid |
| SMILES | CCC(CC)(c1ccc(C#CC2(O)CCCCC2)c(C)c1)c1ccc(OCCCCCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C33H44O4/c1-5-33(6-2,29-16-17-30(26(4)24-29)37-22-12-7-9-13-31(34)35)28-15-14-27(25(3)23-28)18-21-32(36)19-10-8-11-20-32/h14-17,23-24,36H,5-13,19-20,22H2,1-4H3,(H,34,35) |
| InChIKey | PXNRGWAGICIHPX-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|