C34H41NO3 — CID 88968188
1-[2-[2-methyl-4-[3-[3-methyl-4-[6-(2-methylperoxyethyl)-3-pyridinyl]phenyl]pentan-3-yl]phenyl]ethynyl]cyclopentan-1-ol (PubChem CID 88968188) has the molecular formula C34H41NO3 and a molecular weight of 511.71 g/mol. Its IUPAC name is 1-[2-[2-methyl-4-[3-[3-methyl-4-[6-(2-methylperoxyethyl)-3-pyridinyl]phenyl]pentan-3-yl]phenyl]ethynyl]cyclopentan-1-ol.
| Compound Name | 1-[2-[2-methyl-4-[3-[3-methyl-4-[6-(2-methylperoxyethyl)-3-pyridinyl]phenyl]pentan-3-yl]phenyl]ethynyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 88968188 |
| Molecular Formula | C34H41NO3 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | 1-[2-[2-methyl-4-[3-[3-methyl-4-[6-(2-methylperoxyethyl)-3-pyridinyl]phenyl]pentan-3-yl]phenyl]ethynyl]cyclopentan-1-ol |
| SMILES | CCC(CC)(c1ccc(C#CC2(O)CCCC2)c(C)c1)c1ccc(-c2ccc(CCOOC)nc2)c(C)c1 |
| InChI | InChI=1S/C34H41NO3/c1-6-34(7-2,29-12-10-27(25(3)22-29)16-20-33(36)18-8-9-19-33)30-13-15-32(26(4)23-30)28-11-14-31(35-24-28)17-21-38-37-5/h10-15,22-24,36H,6-9,17-19,21H2,1-5H3 |
| InChIKey | DWUWCQANBIBJAB-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|