C35H42O4 — CID 88968242
4-[2-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]ethynyl]oxan-4-ol (PubChem CID 88968242) has the molecular formula C35H42O4 and a molecular weight of 526.72 g/mol. Its IUPAC name is 4-[2-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]ethynyl]oxan-4-ol.
| Compound Name | 4-[2-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]ethynyl]oxan-4-ol |
|---|---|
| PubChem CID | 88968242 |
| Molecular Formula | C35H42O4 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | 4-[2-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]ethynyl]oxan-4-ol |
| SMILES | CCC(CC)(c1ccc(C#CC2(O)CCOCC2)c(C)c1)c1ccc(-c2ccc(CCOOC)cc2)c(C)c1 |
| InChI | InChI=1S/C35H42O4/c1-6-35(7-2,31-13-12-29(26(3)24-31)16-18-34(36)19-22-38-23-20-34)32-14-15-33(27(4)25-32)30-10-8-28(9-11-30)17-21-39-37-5/h8-15,24-25,36H,6-7,17,19-23H2,1-5H3 |
| InChIKey | UHTBVYQUTGZANR-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|