C36H52O3Si — CID 89188444
trimethyl-[3-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]pentan-3-yloxy]silane (PubChem CID 89188444) has the molecular formula C36H52O3Si and a molecular weight of 560.90 g/mol. Its IUPAC name is trimethyl-[3-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]pentan-3-yloxy]silane.
| Compound Name | trimethyl-[3-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]pentan-3-yloxy]silane |
|---|---|
| PubChem CID | 89188444 |
| Molecular Formula | C36H52O3Si |
| Molecular Weight | 560.90 g/mol |
| Exact Mass | 560.37 |
| IUPAC Name | trimethyl-[3-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]pentan-3-yloxy]silane |
| SMILES | CCC(CC)(O[Si](C)(C)C)c1ccc(C(CC)(CC)c2ccc(-c3ccc(CCOOC)cc3)c(C)c2)cc1C |
| InChI | InChI=1S/C36H52O3Si/c1-11-35(12-2,32-20-22-34(28(6)26-32)36(13-3,14-4)39-40(8,9)10)31-19-21-33(27(5)25-31)30-17-15-29(16-18-30)23-24-38-37-7/h15-22,25-26H,11-14,23-24H2,1-10H3 |
| InChIKey | UFPMTIKGHLKSBK-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.90 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|