C35H46O3 — CID 88968147
(E)-3-ethyl-1-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]pent-1-en-3-ol (PubChem CID 88968147) has the molecular formula C35H46O3 and a molecular weight of 514.75 g/mol. Its IUPAC name is (E)-3-ethyl-1-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]pent-1-en-3-ol.
| Compound Name | (E)-3-ethyl-1-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]pent-1-en-3-ol |
|---|---|
| PubChem CID | 88968147 |
| Molecular Formula | C35H46O3 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.34 |
| IUPAC Name | (E)-3-ethyl-1-[2-methyl-4-[3-[3-methyl-4-[4-(2-methylperoxyethyl)phenyl]phenyl]pentan-3-yl]phenyl]pent-1-en-3-ol |
| SMILES | CCC(O)(/C=C/c1ccc(C(CC)(CC)c2ccc(-c3ccc(CCOOC)cc3)c(C)c2)cc1C)CC |
| InChI | InChI=1S/C35H46O3/c1-8-34(36,9-2)22-20-29-16-17-31(24-26(29)5)35(10-3,11-4)32-18-19-33(27(6)25-32)30-14-12-28(13-15-30)21-23-38-37-7/h12-20,22,24-25,36H,8-11,21,23H2,1-7H3/b22-20+ |
| InChIKey | AEWGXRYXGCUXTP-LSDHQDQOSA-N |
| XLogP | 8.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|